C16H33NO3Si — CID 135017071
tert-butyl (2R,4S)-4-[(2-methylpropan-2-yl)oxy]-2-trimethylsilylpyrrolidine-1-carboxylate (PubChem CID 135017071) has the molecular formula C16H33NO3Si and a molecular weight of 315.53 g/mol. Its IUPAC name is tert-butyl (2R,4S)-4-[(2-methylpropan-2-yl)oxy]-2-trimethylsilylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-4-[(2-methylpropan-2-yl)oxy]-2-trimethylsilylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135017071 |
| Molecular Formula | C16H33NO3Si |
| Molecular Weight | 315.53 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | tert-butyl (2R,4S)-4-[(2-methylpropan-2-yl)oxy]-2-trimethylsilylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](OC(C)(C)C)C[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C16H33NO3Si/c1-15(2,3)19-12-10-13(21(7,8)9)17(11-12)14(18)20-16(4,5)6/h12-13H,10-11H2,1-9H3/t12-,13+/m0/s1 |
| InChIKey | HAPZNWWXNUIVNZ-QWHCGFSZSA-N |
| XLogP | 4.06 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|