C16H32N2O2Si — CID 15484301
tert-butyl (1S,2R,5R)-7-methyl-2-trimethylsilyl-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 15484301) has the molecular formula C16H32N2O2Si and a molecular weight of 312.53 g/mol. Its IUPAC name is tert-butyl (1S,2R,5R)-7-methyl-2-trimethylsilyl-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate.
| Compound Name | tert-butyl (1S,2R,5R)-7-methyl-2-trimethylsilyl-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate |
|---|---|
| PubChem CID | 15484301 |
| Molecular Formula | C16H32N2O2Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | tert-butyl (1S,2R,5R)-7-methyl-2-trimethylsilyl-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | CN1C[C@H]2C[C@@H](C1)[C@@H]([Si](C)(C)C)N(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C16H32N2O2Si/c1-16(2,3)20-15(19)18-10-12-8-13(11-17(4)9-12)14(18)21(5,6)7/h12-14H,8-11H2,1-7H3/t12-,13+,14-/m1/s1 |
| InChIKey | GPSWYHIRFLCBKL-HZSPNIEDSA-N |
| XLogP | 3.05 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|