C15H25O6Y- — CID 135018101
methyl (2E)-2-[(2R,6S)-6-[(2R,3R)-2,3-dihydroxybutyl]-2-hydroxy-2-propan-2-yloxan-4-ylidene]acetate;yttrium (PubChem CID 135018101) has the molecular formula C15H25O6Y- and a molecular weight of 390.27 g/mol. Its IUPAC name is methyl (2E)-2-[(2R,6S)-6-[(2R,3R)-2,3-dihydroxybutyl]-2-hydroxy-2-propan-2-yloxan-4-ylidene]acetate;yttrium.
| Compound Name | methyl (2E)-2-[(2R,6S)-6-[(2R,3R)-2,3-dihydroxybutyl]-2-hydroxy-2-propan-2-yloxan-4-ylidene]acetate;yttrium |
|---|---|
| PubChem CID | 135018101 |
| Molecular Formula | C15H25O6Y- |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | methyl (2E)-2-[(2R,6S)-6-[(2R,3R)-2,3-dihydroxybutyl]-2-hydroxy-2-propan-2-yloxan-4-ylidene]acetate;yttrium |
| SMILES | COC(=O)/C=C1\C[C@@H](C[C@@H](O)[C@@H](C)O)O[C@@](O)([C-](C)C)C1.[Y] |
| InChI | InChI=1S/C15H25O6.Y/c1-9(2)15(19)8-11(6-14(18)20-4)5-12(21-15)7-13(17)10(3)16;/h6,10,12-13,16-17,19H,5,7-8H2,1-4H3;/q-1;/b11-6+;/t10-,12+,13-,15-;/m1./s1 |
| InChIKey | QWMQYQKYMDQTIC-LNJODZDMSA-N |
| XLogP | 0.70 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|