C42H44O7S — CID 135018106
(2R,3S,4R,5R,6R)-2-[2-(benzenesulfonyl)ethyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 135018106) has the molecular formula C42H44O7S and a molecular weight of 692.87 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-2-[2-(benzenesulfonyl)ethyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3S,4R,5R,6R)-2-[2-(benzenesulfonyl)ethyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 135018106 |
| Molecular Formula | C42H44O7S |
| Molecular Weight | 692.87 g/mol |
| Exact Mass | 692.28 |
| IUPAC Name | (2R,3S,4R,5R,6R)-2-[2-(benzenesulfonyl)ethyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | O=S(=O)(CC[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H44O7S/c43-50(44,37-24-14-5-15-25-37)27-26-38-40(46-29-34-18-8-2-9-19-34)42(48-31-36-22-12-4-13-23-36)41(47-30-35-20-10-3-11-21-35)39(49-38)32-45-28-33-16-6-1-7-17-33/h1-25,38-42H,26-32H2/t38-,39-,40+,41-,42-/m1/s1 |
| InChIKey | SLAKLWAZDXFNNG-QBLDGPCBSA-N |
| XLogP | 7.59 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.87 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |