C18H27NO6Si — CID 135018976
benzyl (3R,4R,5S)-3,4-dihydroxy-2-oxo-5-(2-trimethylsilyloxypropan-2-yl)pyrrolidine-1-carboxylate (PubChem CID 135018976) has the molecular formula C18H27NO6Si and a molecular weight of 381.50 g/mol. Its IUPAC name is benzyl (3R,4R,5S)-3,4-dihydroxy-2-oxo-5-(2-trimethylsilyloxypropan-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (3R,4R,5S)-3,4-dihydroxy-2-oxo-5-(2-trimethylsilyloxypropan-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135018976 |
| Molecular Formula | C18H27NO6Si |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | benzyl (3R,4R,5S)-3,4-dihydroxy-2-oxo-5-(2-trimethylsilyloxypropan-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(O[Si](C)(C)C)[C@@H]1[C@@H](O)[C@@H](O)C(=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H27NO6Si/c1-18(2,25-26(3,4)5)15-13(20)14(21)16(22)19(15)17(23)24-11-12-9-7-6-8-10-12/h6-10,13-15,20-21H,11H2,1-5H3/t13-,14+,15-/m0/s1 |
| InChIKey | MEQAVWYWHDSKNY-ZNMIVQPWSA-N |
| XLogP | 1.89 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|