C19H32OSi — CID 135019971
(5R)-1-tri(propan-2-yl)silyldec-9-en-1,3-diyn-5-ol (PubChem CID 135019971) has the molecular formula C19H32OSi and a molecular weight of 304.55 g/mol. Its IUPAC name is (5R)-1-tri(propan-2-yl)silyldec-9-en-1,3-diyn-5-ol.
| Compound Name | (5R)-1-tri(propan-2-yl)silyldec-9-en-1,3-diyn-5-ol |
|---|---|
| PubChem CID | 135019971 |
| Molecular Formula | C19H32OSi |
| Molecular Weight | 304.55 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (5R)-1-tri(propan-2-yl)silyldec-9-en-1,3-diyn-5-ol |
| SMILES | C=CCCC[C@@H](O)C#CC#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H32OSi/c1-8-9-10-13-19(20)14-11-12-15-21(16(2)3,17(4)5)18(6)7/h8,16-20H,1,9-10,13H2,2-7H3/t19-/m1/s1 |
| InChIKey | MYWQDDYKCZUGLY-LJQANCHMSA-N |
| XLogP | 4.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|