C25H20N2O5 — CID 135020330
(1S,7S)-10-methyl-4-phenylspiro[13-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridecane-9,2'-indene]-1',3,3',5-tetrone (PubChem CID 135020330) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is (1S,7S)-10-methyl-4-phenylspiro[13-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridecane-9,2'-indene]-1',3,3',5-tetrone.
| Compound Name | (1S,7S)-10-methyl-4-phenylspiro[13-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridecane-9,2'-indene]-1',3,3',5-tetrone |
|---|---|
| PubChem CID | 135020330 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | (1S,7S)-10-methyl-4-phenylspiro[13-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridecane-9,2'-indene]-1',3,3',5-tetrone |
| SMILES | CN1CC2C([C@@H]3O[C@@H]2C2C(=O)N(c4ccccc4)C(=O)C23)C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H20N2O5/c1-26-11-15-18(25(26)21(28)13-9-5-6-10-14(13)22(25)29)20-17-16(19(15)32-20)23(30)27(24(17)31)12-7-3-2-4-8-12/h2-10,15-20H,11H2,1H3/t15?,16?,17?,18?,19-,20+/m0/s1 |
| InChIKey | JSDDDYCEHIVSRH-OZFFSNAHSA-N |
| XLogP | 1.57 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|