C17H24O5 — CID 135020419
ethyl 2-[(5R,6S,9S)-4-methoxy-6,8,9-trimethyl-2-oxo-1-oxaspiro[4.5]deca-3,7-dien-6-yl]acetate (PubChem CID 135020419) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is ethyl 2-[(5R,6S,9S)-4-methoxy-6,8,9-trimethyl-2-oxo-1-oxaspiro[4.5]deca-3,7-dien-6-yl]acetate.
| Compound Name | ethyl 2-[(5R,6S,9S)-4-methoxy-6,8,9-trimethyl-2-oxo-1-oxaspiro[4.5]deca-3,7-dien-6-yl]acetate |
|---|---|
| PubChem CID | 135020419 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | ethyl 2-[(5R,6S,9S)-4-methoxy-6,8,9-trimethyl-2-oxo-1-oxaspiro[4.5]deca-3,7-dien-6-yl]acetate |
| SMILES | CCOC(=O)C[C@@]1(C)C=C(C)[C@@H](C)C[C@@]12OC(=O)C=C2OC |
| InChI | InChI=1S/C17H24O5/c1-6-21-15(19)10-16(4)8-11(2)12(3)9-17(16)13(20-5)7-14(18)22-17/h7-8,12H,6,9-10H2,1-5H3/t12-,16+,17-/m0/s1 |
| InChIKey | YIOAUWWHSYKUIQ-VUCTXSBTSA-N |
| XLogP | 2.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|