C17H23NO3 — CID 135020655
ethyl (1R,2R,3S,7S,9R)-7-cyano-10,10-dimethyl-8-oxotricyclo[7.1.1.02,7]undecane-3-carboxylate (PubChem CID 135020655) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is ethyl (1R,2R,3S,7S,9R)-7-cyano-10,10-dimethyl-8-oxotricyclo[7.1.1.02,7]undecane-3-carboxylate.
| Compound Name | ethyl (1R,2R,3S,7S,9R)-7-cyano-10,10-dimethyl-8-oxotricyclo[7.1.1.02,7]undecane-3-carboxylate |
|---|---|
| PubChem CID | 135020655 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | ethyl (1R,2R,3S,7S,9R)-7-cyano-10,10-dimethyl-8-oxotricyclo[7.1.1.02,7]undecane-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[C@]2(C#N)C(=O)[C@@H]3C[C@H]([C@H]12)C3(C)C |
| InChI | InChI=1S/C17H23NO3/c1-4-21-15(20)10-6-5-7-17(9-18)13(10)11-8-12(14(17)19)16(11,2)3/h10-13H,4-8H2,1-3H3/t10-,11+,12-,13-,17+/m0/s1 |
| InChIKey | LJAZLNVNDRENTN-NLLNSEBYSA-N |
| XLogP | 2.72 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |