C16H23NO3 — CID 135020654
ethyl (1R,4aS,8aR)-4a-cyano-7,7-dimethyl-5-oxo-2,3,4,6,8,8a-hexahydro-1H-naphthalene-1-carboxylate (PubChem CID 135020654) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is ethyl (1R,4aS,8aR)-4a-cyano-7,7-dimethyl-5-oxo-2,3,4,6,8,8a-hexahydro-1H-naphthalene-1-carboxylate.
| Compound Name | ethyl (1R,4aS,8aR)-4a-cyano-7,7-dimethyl-5-oxo-2,3,4,6,8,8a-hexahydro-1H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 135020654 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | ethyl (1R,4aS,8aR)-4a-cyano-7,7-dimethyl-5-oxo-2,3,4,6,8,8a-hexahydro-1H-naphthalene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[C@]2(C#N)C(=O)CC(C)(C)C[C@H]12 |
| InChI | InChI=1S/C16H23NO3/c1-4-20-14(19)11-6-5-7-16(10-17)12(11)8-15(2,3)9-13(16)18/h11-12H,4-9H2,1-3H3/t11-,12-,16-/m1/s1 |
| InChIKey | WZSOULIEXJVZKS-XHBSWPGZSA-N |
| XLogP | 2.86 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |