C17H24BrNO3 — CID 135021149
ethyl 5-bromo-2-[(1R,5R)-3-cyano-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]pentanoate (PubChem CID 135021149) has the molecular formula C17H24BrNO3 and a molecular weight of 370.29 g/mol. Its IUPAC name is ethyl 5-bromo-2-[(1R,5R)-3-cyano-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]pentanoate.
| Compound Name | ethyl 5-bromo-2-[(1R,5R)-3-cyano-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]pentanoate |
|---|---|
| PubChem CID | 135021149 |
| Molecular Formula | C17H24BrNO3 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | ethyl 5-bromo-2-[(1R,5R)-3-cyano-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]pentanoate |
| SMILES | CCOC(=O)C(CCCBr)C1C(C#N)C(=O)[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C17H24BrNO3/c1-4-22-16(21)10(6-5-7-18)14-11(9-19)15(20)13-8-12(14)17(13,2)3/h10-14H,4-8H2,1-3H3/t10?,11?,12-,13+,14?/m1/s1 |
| InChIKey | RTPNEGCPPPISOD-ALRYYZOASA-N |
| XLogP | 3.34 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|