C16H24BrNO3 — CID 135020981
ethyl 5-bromo-2-(2-cyano-5,5-dimethyl-3-oxocyclohexyl)pentanoate (PubChem CID 135020981) has the molecular formula C16H24BrNO3 and a molecular weight of 358.28 g/mol. Its IUPAC name is ethyl 5-bromo-2-(2-cyano-5,5-dimethyl-3-oxocyclohexyl)pentanoate.
| Compound Name | ethyl 5-bromo-2-(2-cyano-5,5-dimethyl-3-oxocyclohexyl)pentanoate |
|---|---|
| PubChem CID | 135020981 |
| Molecular Formula | C16H24BrNO3 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | ethyl 5-bromo-2-(2-cyano-5,5-dimethyl-3-oxocyclohexyl)pentanoate |
| SMILES | CCOC(=O)C(CCCBr)C1CC(C)(C)CC(=O)C1C#N |
| InChI | InChI=1S/C16H24BrNO3/c1-4-21-15(20)11(6-5-7-17)12-8-16(2,3)9-14(19)13(12)10-18/h11-13H,4-9H2,1-3H3 |
| InChIKey | WZDFEYJMCGRGRS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|