C16H23NO3 — CID 135021646
ethyl (1S,4aR,10aR)-4a-cyano-5-oxo-1,2,3,4,6,7,8,9,10,10a-decahydrobenzo[8]annulene-1-carboxylate (PubChem CID 135021646) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is ethyl (1S,4aR,10aR)-4a-cyano-5-oxo-1,2,3,4,6,7,8,9,10,10a-decahydrobenzo[8]annulene-1-carboxylate.
| Compound Name | ethyl (1S,4aR,10aR)-4a-cyano-5-oxo-1,2,3,4,6,7,8,9,10,10a-decahydrobenzo[8]annulene-1-carboxylate |
|---|---|
| PubChem CID | 135021646 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | ethyl (1S,4aR,10aR)-4a-cyano-5-oxo-1,2,3,4,6,7,8,9,10,10a-decahydrobenzo[8]annulene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[C@@]2(C#N)C(=O)CCCCC[C@H]12 |
| InChI | InChI=1S/C16H23NO3/c1-2-20-15(19)12-7-6-10-16(11-17)13(12)8-4-3-5-9-14(16)18/h12-13H,2-10H2,1H3/t12-,13+,16-/m0/s1 |
| InChIKey | KHDZIUFSBHRICR-ZENOOKHLSA-N |
| XLogP | 3.01 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |