C19H23NO7 — CID 135020667
triethyl 5-oxo-2,3-dihydro-1H-2-benzazepine-3,4,4-tricarboxylate (PubChem CID 135020667) has the molecular formula C19H23NO7 and a molecular weight of 377.39 g/mol. Its IUPAC name is triethyl 5-oxo-2,3-dihydro-1H-2-benzazepine-3,4,4-tricarboxylate.
| Compound Name | triethyl 5-oxo-2,3-dihydro-1H-2-benzazepine-3,4,4-tricarboxylate |
|---|---|
| PubChem CID | 135020667 |
| Molecular Formula | C19H23NO7 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | triethyl 5-oxo-2,3-dihydro-1H-2-benzazepine-3,4,4-tricarboxylate |
| SMILES | CCOC(=O)C1NCc2ccccc2C(=O)C1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C19H23NO7/c1-4-25-16(22)14-19(17(23)26-5-2,18(24)27-6-3)15(21)13-10-8-7-9-12(13)11-20-14/h7-10,14,20H,4-6,11H2,1-3H3 |
| InChIKey | IEXFFOWEMQFSIS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|