C15H17NO2 — CID 135021309
(2S,11bR)-2-ethenyl-2-methyl-1,6,7,11b-tetrahydro-[1,3]oxazino[4,3-a]isoquinolin-4-one (PubChem CID 135021309) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is (2S,11bR)-2-ethenyl-2-methyl-1,6,7,11b-tetrahydro-[1,3]oxazino[4,3-a]isoquinolin-4-one.
| Compound Name | (2S,11bR)-2-ethenyl-2-methyl-1,6,7,11b-tetrahydro-[1,3]oxazino[4,3-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 135021309 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (2S,11bR)-2-ethenyl-2-methyl-1,6,7,11b-tetrahydro-[1,3]oxazino[4,3-a]isoquinolin-4-one |
| SMILES | C=C[C@]1(C)C[C@@H]2c3ccccc3CCN2C(=O)O1 |
| InChI | InChI=1S/C15H17NO2/c1-3-15(2)10-13-12-7-5-4-6-11(12)8-9-16(13)14(17)18-15/h3-7,13H,1,8-10H2,2H3/t13-,15-/m1/s1 |
| InChIKey | DKZYOBHBHFRSAG-UKRRQHHQSA-N |
| XLogP | 3.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|