C17H14N2S — CID 135021385
4-methylsulfanyl-3,6-diphenylpyridazine (PubChem CID 135021385) has the molecular formula C17H14N2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 4-methylsulfanyl-3,6-diphenylpyridazine.
| Compound Name | 4-methylsulfanyl-3,6-diphenylpyridazine |
|---|---|
| PubChem CID | 135021385 |
| Molecular Formula | C17H14N2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-methylsulfanyl-3,6-diphenylpyridazine |
| SMILES | CSc1cc(-c2ccccc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C17H14N2S/c1-20-16-12-15(13-8-4-2-5-9-13)18-19-17(16)14-10-6-3-7-11-14/h2-12H,1H3 |
| InChIKey | BNPICOVEIKUUJW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |