C18H24O2S — CID 135022213
[(1Z)-1-methylsulfanyl-3-phenylhexa-1,5-dien-2-yl] 2,2-dimethylpropanoate (PubChem CID 135022213) has the molecular formula C18H24O2S and a molecular weight of 304.46 g/mol. Its IUPAC name is [(1Z)-1-methylsulfanyl-3-phenylhexa-1,5-dien-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1Z)-1-methylsulfanyl-3-phenylhexa-1,5-dien-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135022213 |
| Molecular Formula | C18H24O2S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | [(1Z)-1-methylsulfanyl-3-phenylhexa-1,5-dien-2-yl] 2,2-dimethylpropanoate |
| SMILES | C=CCC(/C(=C/SC)OC(=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H24O2S/c1-6-10-15(14-11-8-7-9-12-14)16(13-21-5)20-17(19)18(2,3)4/h6-9,11-13,15H,1,10H2,2-5H3/b16-13- |
| InChIKey | JGAIFKNTWOLMAH-SSZFMOIBSA-N |
| XLogP | 5.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|