C27H24O2 — CID 135022466
3-(4-ethoxyphenyl)-2,4-diphenyl-5-prop-2-enylfuran (PubChem CID 135022466) has the molecular formula C27H24O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-2,4-diphenyl-5-prop-2-enylfuran.
| Compound Name | 3-(4-ethoxyphenyl)-2,4-diphenyl-5-prop-2-enylfuran |
|---|---|
| PubChem CID | 135022466 |
| Molecular Formula | C27H24O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 3-(4-ethoxyphenyl)-2,4-diphenyl-5-prop-2-enylfuran |
| SMILES | C=CCc1oc(-c2ccccc2)c(-c2ccc(OCC)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C27H24O2/c1-3-11-24-25(20-12-7-5-8-13-20)26(21-16-18-23(19-17-21)28-4-2)27(29-24)22-14-9-6-10-15-22/h3,5-10,12-19H,1,4,11H2,2H3 |
| InChIKey | BCRZHXACUOMCPD-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|