C36H68O5S2Si3 — CID 135022723
[(3R,4R,6R)-3-[(2S,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]sulfanyl-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 135022723) has the molecular formula C36H68O5S2Si3 and a molecular weight of 729.33 g/mol. Its IUPAC name is [(3R,4R,6R)-3-[(2S,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]sulfanyl-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,4R,6R)-3-[(2S,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]sulfanyl-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 135022723 |
| Molecular Formula | C36H68O5S2Si3 |
| Molecular Weight | 729.33 g/mol |
| Exact Mass | 728.38 |
| IUPAC Name | [(3R,4R,6R)-3-[(2S,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]sulfanyl-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1O[C@H](Sc2ccccc2)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1S[C@H]1CC(O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)O1 |
| InChI | InChI=1S/C36H68O5S2Si3/c1-25-32(41-46(16,17)36(9,10)11)28(39-44(12,13)34(3,4)5)23-31(37-25)43-33-26(2)38-30(42-27-21-19-18-20-22-27)24-29(33)40-45(14,15)35(6,7)8/h18-22,25-26,28-33H,23-24H2,1-17H3/t25-,26?,28?,29+,30+,31-,32-,33+/m0/s1 |
| InChIKey | WTCJGEABRAPKFW-XNFOOFQOSA-N |
| XLogP | 11.32 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.33 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|