C21H24O7 — CID 135022747
methyl (1S,3R,7S,8R,13S,15R,16S)-5,15-dihydroxy-15-methyl-2,11-dioxo-7-prop-1-en-2-yl-12-oxatetracyclo[8.5.1.03,8.013,16]hexadeca-4,9-diene-4-carboxylate (PubChem CID 135022747) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is methyl (1S,3R,7S,8R,13S,15R,16S)-5,15-dihydroxy-15-methyl-2,11-dioxo-7-prop-1-en-2-yl-12-oxatetracyclo[8.5.1.03,8.013,16]hexadeca-4,9-diene-4-carboxylate.
| Compound Name | methyl (1S,3R,7S,8R,13S,15R,16S)-5,15-dihydroxy-15-methyl-2,11-dioxo-7-prop-1-en-2-yl-12-oxatetracyclo[8.5.1.03,8.013,16]hexadeca-4,9-diene-4-carboxylate |
|---|---|
| PubChem CID | 135022747 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | methyl (1S,3R,7S,8R,13S,15R,16S)-5,15-dihydroxy-15-methyl-2,11-dioxo-7-prop-1-en-2-yl-12-oxatetracyclo[8.5.1.03,8.013,16]hexadeca-4,9-diene-4-carboxylate |
| SMILES | C=C(C)[C@H]1CC(O)=C(C(=O)OC)[C@@H]2C(=O)[C@H]3[C@H]4C(=C[C@@H]21)C(=O)O[C@H]4C[C@@]3(C)O |
| InChI | InChI=1S/C21H24O7/c1-8(2)9-6-12(22)16(20(25)27-4)15-10(9)5-11-14-13(28-19(11)24)7-21(3,26)17(14)18(15)23/h5,9-10,13-15,17,22,26H,1,6-7H2,2-4H3/t9-,10-,13+,14+,15-,17-,21-/m1/s1 |
| InChIKey | NSVSSGLMENBGNB-JQOWMITHSA-N |
| XLogP | 1.62 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|