C30H54O4S2Si2 — CID 135022832
tert-butyl-[(3S,4R,6R)-3-[(2S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-2-yl]sulfanyl-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-dimethylsilane (PubChem CID 135022832) has the molecular formula C30H54O4S2Si2 and a molecular weight of 599.06 g/mol. Its IUPAC name is tert-butyl-[(3S,4R,6R)-3-[(2S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-2-yl]sulfanyl-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4R,6R)-3-[(2S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-2-yl]sulfanyl-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 135022832 |
| Molecular Formula | C30H54O4S2Si2 |
| Molecular Weight | 599.06 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | tert-butyl-[(3S,4R,6R)-3-[(2S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-2-yl]sulfanyl-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-dimethylsilane |
| SMILES | CC1O[C@H](Sc2ccccc2)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1S[C@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)O1 |
| InChI | InChI=1S/C30H54O4S2Si2/c1-21-24(33-37(9,10)29(3,4)5)18-19-26(31-21)36-28-22(2)32-27(35-23-16-14-13-15-17-23)20-25(28)34-38(11,12)30(6,7)8/h13-17,21-22,24-28H,18-20H2,1-12H3/t21-,22?,24-,25+,26-,27+,28-/m0/s1 |
| InChIKey | DRYVYKKKMSUZDN-VUUZMNINSA-N |
| XLogP | 9.32 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.06 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|