C20H26N4O3 — CID 135022954
N-cyclohexyl-8-methoxy-1,1-dimethyl-3-oxo-2,4-dihydropyrazino[1,2-a]benzimidazole-4-carboxamide (PubChem CID 135022954) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-cyclohexyl-8-methoxy-1,1-dimethyl-3-oxo-2,4-dihydropyrazino[1,2-a]benzimidazole-4-carboxamide.
| Compound Name | N-cyclohexyl-8-methoxy-1,1-dimethyl-3-oxo-2,4-dihydropyrazino[1,2-a]benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 135022954 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-cyclohexyl-8-methoxy-1,1-dimethyl-3-oxo-2,4-dihydropyrazino[1,2-a]benzimidazole-4-carboxamide |
| SMILES | COc1ccc2c(c1)nc1n2C(C(=O)NC2CCCCC2)C(=O)NC1(C)C |
| InChI | InChI=1S/C20H26N4O3/c1-20(2)19-22-14-11-13(27-3)9-10-15(14)24(19)16(18(26)23-20)17(25)21-12-7-5-4-6-8-12/h9-12,16H,4-8H2,1-3H3,(H,21,25)(H,23,26) |
| InChIKey | VOGRMEAFDYACNF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|