C51H68N2 — CID 135024031
4-[4-(9,9-dihexyl-7-methylfluoren-2-yl)phenyl]-1-(2-ethylhexyl)-3-methyl-5-(4-methylphenyl)-2H-imidazole (PubChem CID 135024031) has the molecular formula C51H68N2 and a molecular weight of 709.12 g/mol. Its IUPAC name is 4-[4-(9,9-dihexyl-7-methylfluoren-2-yl)phenyl]-1-(2-ethylhexyl)-3-methyl-5-(4-methylphenyl)-2H-imidazole.
| Compound Name | 4-[4-(9,9-dihexyl-7-methylfluoren-2-yl)phenyl]-1-(2-ethylhexyl)-3-methyl-5-(4-methylphenyl)-2H-imidazole |
|---|---|
| PubChem CID | 135024031 |
| Molecular Formula | C51H68N2 |
| Molecular Weight | 709.12 g/mol |
| Exact Mass | 708.54 |
| IUPAC Name | 4-[4-(9,9-dihexyl-7-methylfluoren-2-yl)phenyl]-1-(2-ethylhexyl)-3-methyl-5-(4-methylphenyl)-2H-imidazole |
| SMILES | CCCCCCC1(CCCCCC)c2cc(C)ccc2-c2ccc(-c3ccc(C4=C(c5ccc(C)cc5)N(CC(CC)CCCC)CN4C)cc3)cc21 |
| InChI | InChI=1S/C51H68N2/c1-8-12-15-17-32-51(33-18-16-13-9-2)47-34-39(6)22-30-45(47)46-31-29-44(35-48(46)51)41-25-27-42(28-26-41)49-50(43-23-20-38(5)21-24-43)53(37-52(49)7)36-40(11-4)19-14-10-3/h20-31,34-35,40H,8-19,32-33,36-37H2,1-7H3 |
| InChIKey | INBMUCVTMQYULW-UHFFFAOYSA-N |
| XLogP | 14.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.12 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|