C16H26O2S2 — CID 135024211
ethyl (9S,10R)-9-methyl-10-prop-1-en-2-yl-1,5-dithiaspiro[5.5]undecane-9-carboxylate (PubChem CID 135024211) has the molecular formula C16H26O2S2 and a molecular weight of 314.52 g/mol. Its IUPAC name is ethyl (9S,10R)-9-methyl-10-prop-1-en-2-yl-1,5-dithiaspiro[5.5]undecane-9-carboxylate.
| Compound Name | ethyl (9S,10R)-9-methyl-10-prop-1-en-2-yl-1,5-dithiaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 135024211 |
| Molecular Formula | C16H26O2S2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | ethyl (9S,10R)-9-methyl-10-prop-1-en-2-yl-1,5-dithiaspiro[5.5]undecane-9-carboxylate |
| SMILES | C=C(C)[C@H]1CC2(CC[C@]1(C)C(=O)OCC)SCCCS2 |
| InChI | InChI=1S/C16H26O2S2/c1-5-18-14(17)15(4)7-8-16(11-13(15)12(2)3)19-9-6-10-20-16/h13H,2,5-11H2,1,3-4H3/t13-,15+/m1/s1 |
| InChIKey | OVUGOESFYATRAK-HIFRSBDPSA-N |
| XLogP | 4.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|