C21H38O — CID 135024541
6-heptyl-4-[(E)-non-1-enyl]-3,6-dihydro-2H-pyran (PubChem CID 135024541) has the molecular formula C21H38O and a molecular weight of 306.53 g/mol. Its IUPAC name is 6-heptyl-4-[(E)-non-1-enyl]-3,6-dihydro-2H-pyran.
| Compound Name | 6-heptyl-4-[(E)-non-1-enyl]-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 135024541 |
| Molecular Formula | C21H38O |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | 6-heptyl-4-[(E)-non-1-enyl]-3,6-dihydro-2H-pyran |
| SMILES | CCCCCCC/C=C/C1=CC(CCCCCCC)OCC1 |
| InChI | InChI=1S/C21H38O/c1-3-5-7-9-10-12-13-15-20-17-18-22-21(19-20)16-14-11-8-6-4-2/h13,15,19,21H,3-12,14,16-18H2,1-2H3/b15-13+ |
| InChIKey | SIEZEJVFKUQXGX-FYWRMAATSA-N |
| XLogP | 6.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|