C23H35NO4Si — CID 135026523
2-[[(3S)-2-benzyl-3-[(4S)-2-but-3-enyl-1,3-dioxolan-4-yl]-3,6-dihydrooxazin-4-yl]oxy]ethyl-trimethylsilane (PubChem CID 135026523) has the molecular formula C23H35NO4Si and a molecular weight of 417.62 g/mol. Its IUPAC name is 2-[[(3S)-2-benzyl-3-[(4S)-2-but-3-enyl-1,3-dioxolan-4-yl]-3,6-dihydrooxazin-4-yl]oxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(3S)-2-benzyl-3-[(4S)-2-but-3-enyl-1,3-dioxolan-4-yl]-3,6-dihydrooxazin-4-yl]oxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 135026523 |
| Molecular Formula | C23H35NO4Si |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 2-[[(3S)-2-benzyl-3-[(4S)-2-but-3-enyl-1,3-dioxolan-4-yl]-3,6-dihydrooxazin-4-yl]oxy]ethyl-trimethylsilane |
| SMILES | C=CCCC1OC[C@H]([C@H]2C(OCC[Si](C)(C)C)=CCON2Cc2ccccc2)O1 |
| InChI | InChI=1S/C23H35NO4Si/c1-5-6-12-22-26-18-21(28-22)23-20(25-15-16-29(2,3)4)13-14-27-24(23)17-19-10-8-7-9-11-19/h5,7-11,13,21-23H,1,6,12,14-18H2,2-4H3/t21-,22?,23-/m1/s1 |
| InChIKey | QPGYEEYCXUQHFE-OJVMETQDSA-N |
| XLogP | 4.75 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|