C39H45NO4Si — CID 135026610
(2S,3S,4S)-5-benzylimino-1,3,4-tris(phenylmethoxy)-8-trimethylsilyloct-7-yn-2-ol (PubChem CID 135026610) has the molecular formula C39H45NO4Si and a molecular weight of 619.88 g/mol. Its IUPAC name is (2S,3S,4S)-5-benzylimino-1,3,4-tris(phenylmethoxy)-8-trimethylsilyloct-7-yn-2-ol.
| Compound Name | (2S,3S,4S)-5-benzylimino-1,3,4-tris(phenylmethoxy)-8-trimethylsilyloct-7-yn-2-ol |
|---|---|
| PubChem CID | 135026610 |
| Molecular Formula | C39H45NO4Si |
| Molecular Weight | 619.88 g/mol |
| Exact Mass | 619.31 |
| IUPAC Name | (2S,3S,4S)-5-benzylimino-1,3,4-tris(phenylmethoxy)-8-trimethylsilyloct-7-yn-2-ol |
| SMILES | C[Si](C)(C)C#CC/C(=N\Cc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C39H45NO4Si/c1-45(2,3)26-16-25-36(40-27-32-17-8-4-9-18-32)38(43-29-34-21-12-6-13-22-34)39(44-30-35-23-14-7-15-24-35)37(41)31-42-28-33-19-10-5-11-20-33/h4-15,17-24,37-39,41H,25,27-31H2,1-3H3/b40-36+/t37-,38-,39-/m0/s1 |
| InChIKey | ZKBVZIRBFKFDIQ-KEEIQDLQSA-N |
| XLogP | 7.65 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.88 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|