C16H21NO4 — CID 135026658
(1R,5S,6S,8S,9S)-2-benzyl-6-ethenyl-8-(hydroxymethyl)-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-ol (PubChem CID 135026658) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is (1R,5S,6S,8S,9S)-2-benzyl-6-ethenyl-8-(hydroxymethyl)-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-ol.
| Compound Name | (1R,5S,6S,8S,9S)-2-benzyl-6-ethenyl-8-(hydroxymethyl)-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-ol |
|---|---|
| PubChem CID | 135026658 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (1R,5S,6S,8S,9S)-2-benzyl-6-ethenyl-8-(hydroxymethyl)-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-ol |
| SMILES | C=C[C@@H]1O[C@H](CO)[C@H]2[C@@H](O)[C@@H]1CON2Cc1ccccc1 |
| InChI | InChI=1S/C16H21NO4/c1-2-13-12-10-20-17(8-11-6-4-3-5-7-11)15(16(12)19)14(9-18)21-13/h2-7,12-16,18-19H,1,8-10H2/t12-,13+,14-,15+,16+/m1/s1 |
| InChIKey | IWJOUZZSPGKVFQ-LEOABGAYSA-N |
| XLogP | 0.73 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|