C31H35NO4 — CID 135026705
(1S)-1-[(3S,4R,5S)-2-benzyl-5-[(1E)-buta-1,3-dienyl]-4-phenylmethoxyoxazinan-3-yl]-2-phenylmethoxyethanol (PubChem CID 135026705) has the molecular formula C31H35NO4 and a molecular weight of 485.62 g/mol. Its IUPAC name is (1S)-1-[(3S,4R,5S)-2-benzyl-5-[(1E)-buta-1,3-dienyl]-4-phenylmethoxyoxazinan-3-yl]-2-phenylmethoxyethanol.
| Compound Name | (1S)-1-[(3S,4R,5S)-2-benzyl-5-[(1E)-buta-1,3-dienyl]-4-phenylmethoxyoxazinan-3-yl]-2-phenylmethoxyethanol |
|---|---|
| PubChem CID | 135026705 |
| Molecular Formula | C31H35NO4 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | (1S)-1-[(3S,4R,5S)-2-benzyl-5-[(1E)-buta-1,3-dienyl]-4-phenylmethoxyoxazinan-3-yl]-2-phenylmethoxyethanol |
| SMILES | C=C/C=C/[C@H]1CON(Cc2ccccc2)[C@@H]([C@H](O)COCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H35NO4/c1-2-3-19-28-23-36-32(20-25-13-7-4-8-14-25)30(31(28)35-22-27-17-11-6-12-18-27)29(33)24-34-21-26-15-9-5-10-16-26/h2-19,28-31,33H,1,20-24H2/b19-3+/t28-,29+,30-,31+/m0/s1 |
| InChIKey | MDBDMSKWIFUHRR-CJGYCYMSSA-N |
| XLogP | 5.32 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|