C18H13ClF3N7O2 — CID 135027489
2,4-diamino-5-[5-chloro-2-(trifluoromethyl)phenyl]-6-nitro-5,7,8,9-tetrahydroimidazo[1,2-a][1,8]naphthyridine-3-carbonitrile (PubChem CID 135027489) has the molecular formula C18H13ClF3N7O2 and a molecular weight of 451.80 g/mol. Its IUPAC name is 2,4-diamino-5-[5-chloro-2-(trifluoromethyl)phenyl]-6-nitro-5,7,8,9-tetrahydroimidazo[1,2-a][1,8]naphthyridine-3-carbonitrile.
| Compound Name | 2,4-diamino-5-[5-chloro-2-(trifluoromethyl)phenyl]-6-nitro-5,7,8,9-tetrahydroimidazo[1,2-a][1,8]naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135027489 |
| Molecular Formula | C18H13ClF3N7O2 |
| Molecular Weight | 451.80 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 2,4-diamino-5-[5-chloro-2-(trifluoromethyl)phenyl]-6-nitro-5,7,8,9-tetrahydroimidazo[1,2-a][1,8]naphthyridine-3-carbonitrile |
| SMILES | N#Cc1c(N)nc2c(c1N)C(c1cc(Cl)ccc1C(F)(F)F)C([N+](=O)[O-])=C1NCCN12 |
| InChI | InChI=1S/C18H13ClF3N7O2/c19-7-1-2-10(18(20,21)22)8(5-7)11-12-13(24)9(6-23)15(25)27-16(12)28-4-3-26-17(28)14(11)29(30)31/h1-2,5,11,26H,3-4H2,(H4,24,25,27) |
| InChIKey | UCLDOLLKNKFUSU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 147.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.80 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|