C18H15ClN6O2 — CID 146001335
6-amino-8-(2-chloroquinolin-3-yl)-9-nitro-2,3,4,8-tetrahydro-1H-pyrido[1,2-a]pyrimidine-7-carbonitrile (PubChem CID 146001335) has the molecular formula C18H15ClN6O2 and a molecular weight of 382.81 g/mol. Its IUPAC name is 6-amino-8-(2-chloroquinolin-3-yl)-9-nitro-2,3,4,8-tetrahydro-1H-pyrido[1,2-a]pyrimidine-7-carbonitrile.
| Compound Name | 6-amino-8-(2-chloroquinolin-3-yl)-9-nitro-2,3,4,8-tetrahydro-1H-pyrido[1,2-a]pyrimidine-7-carbonitrile |
|---|---|
| PubChem CID | 146001335 |
| Molecular Formula | C18H15ClN6O2 |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 6-amino-8-(2-chloroquinolin-3-yl)-9-nitro-2,3,4,8-tetrahydro-1H-pyrido[1,2-a]pyrimidine-7-carbonitrile |
| SMILES | N#CC1=C(N)N2CCCNC2=C([N+](=O)[O-])C1c1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C18H15ClN6O2/c19-16-11(8-10-4-1-2-5-13(10)23-16)14-12(9-20)17(21)24-7-3-6-22-18(24)15(14)25(26)27/h1-2,4-5,8,14,22H,3,6-7,21H2 |
| InChIKey | BTJFURKNBAUCIB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|