C24H20ClN5O — CID 71598258
2-amino-4-(2-chloroquinolin-3-yl)-5-oxo-1-pyridin-3-yl-2,3,4,6,7,8-hexahydroquinoline-3-carbonitrile (PubChem CID 71598258) has the molecular formula C24H20ClN5O and a molecular weight of 429.91 g/mol. Its IUPAC name is 2-amino-4-(2-chloroquinolin-3-yl)-5-oxo-1-pyridin-3-yl-2,3,4,6,7,8-hexahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-4-(2-chloroquinolin-3-yl)-5-oxo-1-pyridin-3-yl-2,3,4,6,7,8-hexahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 71598258 |
| Molecular Formula | C24H20ClN5O |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2-amino-4-(2-chloroquinolin-3-yl)-5-oxo-1-pyridin-3-yl-2,3,4,6,7,8-hexahydroquinoline-3-carbonitrile |
| SMILES | N#CC1C(c2cc3ccccc3nc2Cl)C2=C(CCCC2=O)N(c2cccnc2)C1N |
| InChI | InChI=1S/C24H20ClN5O/c25-23-16(11-14-5-1-2-7-18(14)29-23)21-17(12-26)24(27)30(15-6-4-10-28-13-15)19-8-3-9-20(31)22(19)21/h1-2,4-7,10-11,13,17,21,24H,3,8-9,27H2 |
| InChIKey | JGFOKIKQWFOVDI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|