C20H12Cl2N4O3S — CID 155927986
4-(2,7-dichloroquinolin-3-yl)-6-(methylamino)-5-nitro-2-thiophen-2-yl-4H-pyran-3-carbonitrile (PubChem CID 155927986) has the molecular formula C20H12Cl2N4O3S and a molecular weight of 459.31 g/mol. Its IUPAC name is 4-(2,7-dichloroquinolin-3-yl)-6-(methylamino)-5-nitro-2-thiophen-2-yl-4H-pyran-3-carbonitrile.
| Compound Name | 4-(2,7-dichloroquinolin-3-yl)-6-(methylamino)-5-nitro-2-thiophen-2-yl-4H-pyran-3-carbonitrile |
|---|---|
| PubChem CID | 155927986 |
| Molecular Formula | C20H12Cl2N4O3S |
| Molecular Weight | 459.31 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | 4-(2,7-dichloroquinolin-3-yl)-6-(methylamino)-5-nitro-2-thiophen-2-yl-4H-pyran-3-carbonitrile |
| SMILES | CNC1=C([N+](=O)[O-])C(c2cc3ccc(Cl)cc3nc2Cl)C(C#N)=C(c2cccs2)O1 |
| InChI | InChI=1S/C20H12Cl2N4O3S/c1-24-20-17(26(27)28)16(13(9-23)18(29-20)15-3-2-6-30-15)12-7-10-4-5-11(21)8-14(10)25-19(12)22/h2-8,16,24H,1H3 |
| InChIKey | YTRBGNGIIPQODK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.31 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|