C24H18Cl2N4O2 — CID 23908247
6-amino-4-(2-chloro-6-methylquinolin-3-yl)-N-(4-chlorophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxamide (PubChem CID 23908247) has the molecular formula C24H18Cl2N4O2 and a molecular weight of 465.34 g/mol. Its IUPAC name is 6-amino-4-(2-chloro-6-methylquinolin-3-yl)-N-(4-chlorophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxamide.
| Compound Name | 6-amino-4-(2-chloro-6-methylquinolin-3-yl)-N-(4-chlorophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxamide |
|---|---|
| PubChem CID | 23908247 |
| Molecular Formula | C24H18Cl2N4O2 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 6-amino-4-(2-chloro-6-methylquinolin-3-yl)-N-(4-chlorophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(Cl)cc2)C(c2cc3cc(C)ccc3nc2Cl)C(C#N)=C(N)O1 |
| InChI | InChI=1S/C24H18Cl2N4O2/c1-12-3-8-19-14(9-12)10-17(22(26)30-19)21-18(11-27)23(28)32-13(2)20(21)24(31)29-16-6-4-15(25)5-7-16/h3-10,21H,28H2,1-2H3,(H,29,31) |
| InChIKey | YBWZZMZMOKQWCY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|