C20H15Cl2N3O2 — CID 3346478
6-amino-4-(2-chlorophenyl)-N-(4-chlorophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxamide (PubChem CID 3346478) has the molecular formula C20H15Cl2N3O2 and a molecular weight of 400.27 g/mol. Its IUPAC name is 6-amino-4-(2-chlorophenyl)-N-(4-chlorophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxamide.
| Compound Name | 6-amino-4-(2-chlorophenyl)-N-(4-chlorophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxamide |
|---|---|
| PubChem CID | 3346478 |
| Molecular Formula | C20H15Cl2N3O2 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 6-amino-4-(2-chlorophenyl)-N-(4-chlorophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(Cl)cc2)C(c2ccccc2Cl)C(C#N)=C(N)O1 |
| InChI | InChI=1S/C20H15Cl2N3O2/c1-11-17(20(26)25-13-8-6-12(21)7-9-13)18(15(10-23)19(24)27-11)14-4-2-3-5-16(14)22/h2-9,18H,24H2,1H3,(H,25,26) |
| InChIKey | PDBJYNNWDXRXMU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |