C15H17N3O4 — CID 155294760
8-(2-methoxyphenyl)-9-nitro-1,2,3,4,7,8-hexahydropyrido[1,2-a]pyrimidin-6-one (PubChem CID 155294760) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 8-(2-methoxyphenyl)-9-nitro-1,2,3,4,7,8-hexahydropyrido[1,2-a]pyrimidin-6-one.
| Compound Name | 8-(2-methoxyphenyl)-9-nitro-1,2,3,4,7,8-hexahydropyrido[1,2-a]pyrimidin-6-one |
|---|---|
| PubChem CID | 155294760 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 8-(2-methoxyphenyl)-9-nitro-1,2,3,4,7,8-hexahydropyrido[1,2-a]pyrimidin-6-one |
| SMILES | COc1ccccc1C1CC(=O)N2CCCNC2=C1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N3O4/c1-22-12-6-3-2-5-10(12)11-9-13(19)17-8-4-7-16-15(17)14(11)18(20)21/h2-3,5-6,11,16H,4,7-9H2,1H3 |
| InChIKey | PPYGQLIHSYTERJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|