C23H29NO5S — CID 135027961
(2R)-2-[(3aS,4R,6R,6aR)-5-benzyl-2,2,6-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-2-(benzenesulfonyl)ethanol (PubChem CID 135027961) has the molecular formula C23H29NO5S and a molecular weight of 431.55 g/mol. Its IUPAC name is (2R)-2-[(3aS,4R,6R,6aR)-5-benzyl-2,2,6-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-2-(benzenesulfonyl)ethanol.
| Compound Name | (2R)-2-[(3aS,4R,6R,6aR)-5-benzyl-2,2,6-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-2-(benzenesulfonyl)ethanol |
|---|---|
| PubChem CID | 135027961 |
| Molecular Formula | C23H29NO5S |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (2R)-2-[(3aS,4R,6R,6aR)-5-benzyl-2,2,6-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-2-(benzenesulfonyl)ethanol |
| SMILES | C[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@H]([C@H](CO)S(=O)(=O)c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H29NO5S/c1-16-21-22(29-23(2,3)28-21)20(24(16)14-17-10-6-4-7-11-17)19(15-25)30(26,27)18-12-8-5-9-13-18/h4-13,16,19-22,25H,14-15H2,1-3H3/t16-,19+,20+,21-,22+/m1/s1 |
| InChIKey | NVSPWDUMKPTUIY-UGTAXJHQSA-N |
| XLogP | 2.61 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |