C22H27BrN2O4 — CID 135028311
ethyl N-[4-(N-benzyl-2-bromo-4-methoxyanilino)-4-oxobutyl]-N-methylcarbamate (PubChem CID 135028311) has the molecular formula C22H27BrN2O4 and a molecular weight of 463.37 g/mol. Its IUPAC name is ethyl N-[4-(N-benzyl-2-bromo-4-methoxyanilino)-4-oxobutyl]-N-methylcarbamate.
| Compound Name | ethyl N-[4-(N-benzyl-2-bromo-4-methoxyanilino)-4-oxobutyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 135028311 |
| Molecular Formula | C22H27BrN2O4 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | ethyl N-[4-(N-benzyl-2-bromo-4-methoxyanilino)-4-oxobutyl]-N-methylcarbamate |
| SMILES | CCOC(=O)N(C)CCCC(=O)N(Cc1ccccc1)c1ccc(OC)cc1Br |
| InChI | InChI=1S/C22H27BrN2O4/c1-4-29-22(27)24(2)14-8-11-21(26)25(16-17-9-6-5-7-10-17)20-13-12-18(28-3)15-19(20)23/h5-7,9-10,12-13,15H,4,8,11,14,16H2,1-3H3 |
| InChIKey | QXFBHABEPMRSTA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |