C22H19N5O — CID 135029980
2-N-(4-methoxyphenyl)-4-N,6-diphenyl-1,3,5-triazine-2,4-diamine (PubChem CID 135029980) has the molecular formula C22H19N5O and a molecular weight of 369.43 g/mol. Its IUPAC name is 2-N-(4-methoxyphenyl)-4-N,6-diphenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-methoxyphenyl)-4-N,6-diphenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 135029980 |
| Molecular Formula | C22H19N5O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-N-(4-methoxyphenyl)-4-N,6-diphenyl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(Nc3ccccc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H19N5O/c1-28-19-14-12-18(13-15-19)24-22-26-20(16-8-4-2-5-9-16)25-21(27-22)23-17-10-6-3-7-11-17/h2-15H,1H3,(H2,23,24,25,26,27) |
| InChIKey | XDMARHSXDIRKHT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |