C19H34O3S2 — CID 135030978
(7R,9R)-9-[(2-ethyl-1,3-dioxolan-2-yl)methyl]-7-pentyl-8-oxa-1,5-dithiaspiro[5.5]undecane (PubChem CID 135030978) has the molecular formula C19H34O3S2 and a molecular weight of 374.61 g/mol. Its IUPAC name is (7R,9R)-9-[(2-ethyl-1,3-dioxolan-2-yl)methyl]-7-pentyl-8-oxa-1,5-dithiaspiro[5.5]undecane.
| Compound Name | (7R,9R)-9-[(2-ethyl-1,3-dioxolan-2-yl)methyl]-7-pentyl-8-oxa-1,5-dithiaspiro[5.5]undecane |
|---|---|
| PubChem CID | 135030978 |
| Molecular Formula | C19H34O3S2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (7R,9R)-9-[(2-ethyl-1,3-dioxolan-2-yl)methyl]-7-pentyl-8-oxa-1,5-dithiaspiro[5.5]undecane |
| SMILES | CCCCC[C@H]1O[C@@H](CC2(CC)OCCO2)CCC12SCCCS2 |
| InChI | InChI=1S/C19H34O3S2/c1-3-5-6-8-17-19(23-13-7-14-24-19)10-9-16(22-17)15-18(4-2)20-11-12-21-18/h16-17H,3-15H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | KSQZOYPPFBXFFB-IAGOWNOFSA-N |
| XLogP | 5.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|