C16H26O5S2 — CID 583600
[2,2-dimethyl-6-[(2-methyl-1,3-dithian-2-yl)methyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate (PubChem CID 583600) has the molecular formula C16H26O5S2 and a molecular weight of 362.51 g/mol. Its IUPAC name is [2,2-dimethyl-6-[(2-methyl-1,3-dithian-2-yl)methyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate.
| Compound Name | [2,2-dimethyl-6-[(2-methyl-1,3-dithian-2-yl)methyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
|---|---|
| PubChem CID | 583600 |
| Molecular Formula | C16H26O5S2 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | [2,2-dimethyl-6-[(2-methyl-1,3-dithian-2-yl)methyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
| SMILES | CC(=O)OC1C(CC2(C)SCCCS2)OCC2OC(C)(C)OC21 |
| InChI | InChI=1S/C16H26O5S2/c1-10(17)19-13-11(8-16(4)22-6-5-7-23-16)18-9-12-14(13)21-15(2,3)20-12/h11-14H,5-9H2,1-4H3 |
| InChIKey | OFSIIWFVDWNRBU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |