C17H26O7S2 — CID 583601
[4,5-diacetyloxy-6-[(2-methyl-1,3-dithian-2-yl)methyl]oxan-3-yl] acetate (PubChem CID 583601) has the molecular formula C17H26O7S2 and a molecular weight of 406.52 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-[(2-methyl-1,3-dithian-2-yl)methyl]oxan-3-yl] acetate.
| Compound Name | [4,5-diacetyloxy-6-[(2-methyl-1,3-dithian-2-yl)methyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 583601 |
| Molecular Formula | C17H26O7S2 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [4,5-diacetyloxy-6-[(2-methyl-1,3-dithian-2-yl)methyl]oxan-3-yl] acetate |
| SMILES | CC(=O)OC1COC(CC2(C)SCCCS2)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C17H26O7S2/c1-10(18)22-14-9-21-13(8-17(4)25-6-5-7-26-17)15(23-11(2)19)16(14)24-12(3)20/h13-16H,5-9H2,1-4H3 |
| InChIKey | AUTUXRMOJZEORU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|