C25H20O — CID 135031279
phenyl-[(1R,10S,11R)-11-tetracyclo[8.7.1.02,7.012,17]octadeca-2,4,6,8,12,14,16-heptaenyl]methanone (PubChem CID 135031279) has the molecular formula C25H20O and a molecular weight of 336.43 g/mol. Its IUPAC name is phenyl-[(1R,10S,11R)-11-tetracyclo[8.7.1.02,7.012,17]octadeca-2,4,6,8,12,14,16-heptaenyl]methanone.
| Compound Name | phenyl-[(1R,10S,11R)-11-tetracyclo[8.7.1.02,7.012,17]octadeca-2,4,6,8,12,14,16-heptaenyl]methanone |
|---|---|
| PubChem CID | 135031279 |
| Molecular Formula | C25H20O |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | phenyl-[(1R,10S,11R)-11-tetracyclo[8.7.1.02,7.012,17]octadeca-2,4,6,8,12,14,16-heptaenyl]methanone |
| SMILES | O=C(c1ccccc1)[C@H]1c2ccccc2[C@@H]2C[C@H]1C=Cc1ccccc12 |
| InChI | InChI=1S/C25H20O/c26-25(18-9-2-1-3-10-18)24-19-15-14-17-8-4-5-11-20(17)23(16-19)21-12-6-7-13-22(21)24/h1-15,19,23-24H,16H2/t19-,23-,24-/m1/s1 |
| InChIKey | KEEUYQRPAZEJGC-CTUHWIOQSA-N |
| XLogP | 5.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |