C25H33NO5S — CID 135031862
[1-(2,3-dihydro-1-benzofuran-3-ylmethoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 4-methylbenzenesulfonate (PubChem CID 135031862) has the molecular formula C25H33NO5S and a molecular weight of 459.61 g/mol. Its IUPAC name is [1-(2,3-dihydro-1-benzofuran-3-ylmethoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [1-(2,3-dihydro-1-benzofuran-3-ylmethoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135031862 |
| Molecular Formula | C25H33NO5S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | [1-(2,3-dihydro-1-benzofuran-3-ylmethoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CC(C)(C)N(OCC3COc4ccccc43)C(C)(C)C2)cc1 |
| InChI | InChI=1S/C25H33NO5S/c1-18-10-12-21(13-11-18)32(27,28)31-20-14-24(2,3)26(25(4,5)15-20)30-17-19-16-29-23-9-7-6-8-22(19)23/h6-13,19-20H,14-17H2,1-5H3 |
| InChIKey | VDNJNAKVGVYWGP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|