C21H31NO2 — CID 177413833
2,2,6,6-tetramethyl-1-[[(2R,3R)-2-prop-2-enyl-2,3-dihydro-1-benzofuran-3-yl]methoxy]piperidine (PubChem CID 177413833) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-[[(2R,3R)-2-prop-2-enyl-2,3-dihydro-1-benzofuran-3-yl]methoxy]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-[[(2R,3R)-2-prop-2-enyl-2,3-dihydro-1-benzofuran-3-yl]methoxy]piperidine |
|---|---|
| PubChem CID | 177413833 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-[[(2R,3R)-2-prop-2-enyl-2,3-dihydro-1-benzofuran-3-yl]methoxy]piperidine |
| SMILES | C=CC[C@H]1Oc2ccccc2[C@@H]1CON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C21H31NO2/c1-6-10-18-17(16-11-7-8-12-19(16)24-18)15-23-22-20(2,3)13-9-14-21(22,4)5/h6-8,11-12,17-18H,1,9-10,13-15H2,2-5H3/t17-,18+/m0/s1 |
| InChIKey | LXHBYFWKXLXHFO-ZWKOTPCHSA-N |
| XLogP | 5.08 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|