C21H29NO3 — CID 135031861
1-(2,3-dihydro-1-benzofuran-3-ylmethoxy)-2,2,6,6-tetramethyl-4-prop-2-ynoxypiperidine (PubChem CID 135031861) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-3-ylmethoxy)-2,2,6,6-tetramethyl-4-prop-2-ynoxypiperidine.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-3-ylmethoxy)-2,2,6,6-tetramethyl-4-prop-2-ynoxypiperidine |
|---|---|
| PubChem CID | 135031861 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-3-ylmethoxy)-2,2,6,6-tetramethyl-4-prop-2-ynoxypiperidine |
| SMILES | C#CCOC1CC(C)(C)N(OCC2COc3ccccc32)C(C)(C)C1 |
| InChI | InChI=1S/C21H29NO3/c1-6-11-23-17-12-20(2,3)22(21(4,5)13-17)25-15-16-14-24-19-10-8-7-9-18(16)19/h1,7-10,16-17H,11-15H2,2-5H3 |
| InChIKey | AAMOVXGCLNPBQR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|