C23H41NO2 — CID 54042744
2,4-dimethyl-1-pentoxybenzene;1-methoxy-2,2,6,6-tetramethylpiperidine (PubChem CID 54042744) has the molecular formula C23H41NO2 and a molecular weight of 363.59 g/mol. Its IUPAC name is 2,4-dimethyl-1-pentoxybenzene;1-methoxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 2,4-dimethyl-1-pentoxybenzene;1-methoxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 54042744 |
| Molecular Formula | C23H41NO2 |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.31 |
| IUPAC Name | 2,4-dimethyl-1-pentoxybenzene;1-methoxy-2,2,6,6-tetramethylpiperidine |
| SMILES | CCCCCOc1ccc(C)cc1C.CON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C13H20O.C10H21NO/c1-4-5-6-9-14-13-8-7-11(2)10-12(13)3;1-9(2)7-6-8-10(3,4)11(9)12-5/h7-8,10H,4-6,9H2,1-3H3;6-8H2,1-5H3 |
| InChIKey | LNMHLRXOUOIRKJ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|