C15H27N3O6 — CID 135032032
tert-butyl 3-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]amino]-3-(nitromethyl)azetidine-1-carboxylate (PubChem CID 135032032) has the molecular formula C15H27N3O6 and a molecular weight of 345.40 g/mol. Its IUPAC name is tert-butyl 3-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]amino]-3-(nitromethyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]amino]-3-(nitromethyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 135032032 |
| Molecular Formula | C15H27N3O6 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | tert-butyl 3-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]amino]-3-(nitromethyl)azetidine-1-carboxylate |
| SMILES | COC(=O)[C@@H](NC1(C[N+](=O)[O-])CN(C(=O)OC(C)(C)C)C1)C(C)C |
| InChI | InChI=1S/C15H27N3O6/c1-10(2)11(12(19)23-6)16-15(9-18(21)22)7-17(8-15)13(20)24-14(3,4)5/h10-11,16H,7-9H2,1-6H3/t11-/m0/s1 |
| InChIKey | MLQLOZRVDJUTPB-NSHDSACASA-N |
| XLogP | 1.04 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|