About 4-O-tert-butyl 1-O-methyl (2S)-2-[[3-(nitromethyl)oxetan-3-yl]amino]butanedioate
4-O-tert-butyl 1-O-methyl (2S)-2-[[3-(nitromethyl)oxetan-3-yl]amino]butanedioate (PubChem CID 135031824) has the molecular formula C13H22N2O7
and a molecular weight of 318.33 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl (2S)-2-[[3-(nitromethyl)oxetan-3-yl]amino]butanedioate.
Molecular Properties
| Compound Name | 4-O-tert-butyl 1-O-methyl (2S)-2-[[3-(nitromethyl)oxetan-3-yl]amino]butanedioate |
| PubChem CID | 135031824 |
| Molecular Formula | C13H22N2O7 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl (2S)-2-[[3-(nitromethyl)oxetan-3-yl]amino]butanedioate |
| SMILES | COC(=O)[C@H](CC(=O)OC(C)(C)C)NC1(C[N+](=O)[O-])COC1 |
| InChI | InChI=1S/C13H22N2O7/c1-12(2,3)22-10(16)5-9(11(17)20-4)14-13(6-15(18)19)7-21-8-13/h9,14H,5-8H2,1-4H3/t9-/m0/s1 |
| InChIKey | RJYHXNLVRNHWKX-VIFPVBQESA-N |
| XLogP | -0.10 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-O-tert-butyl 1-O-methyl (2S)-2-[[3-(nitromethyl)oxetan-3-yl]amino]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-tert-butyl 1-O-methyl (2S)-2-[[3-(nitromethyl)oxetan-3-yl]amino]butanedioate?
The IUPAC name of 4-O-tert-butyl 1-O-methyl (2S)-2-[[3-(nitromethyl)oxetan-3-yl]amino]butanedioate (CID 135031824) is 4-O-tert-butyl 1-O-methyl (2S)-2-[[3-(nitromethyl)oxetan-3-yl]amino]butanedioate.
What is the SMILES notation for 4-O-tert-butyl 1-O-methyl (2S)-2-[[3-(nitromethyl)oxetan-3-yl]amino]butanedioate?
The canonical SMILES for 4-O-tert-butyl 1-O-methyl (2S)-2-[[3-(nitromethyl)oxetan-3-yl]amino]butanedioate is COC(=O)[C@H](CC(=O)OC(C)(C)C)NC1(C[N+](=O)[O-])COC1.
What is the InChIKey of 4-O-tert-butyl 1-O-methyl (2S)-2-[[3-(nitromethyl)oxetan-3-yl]amino]butanedioate?
The InChIKey is RJYHXNLVRNHWKX-VIFPVBQESA-N. The full InChI is InChI=1S/C13H22N2O7/c1-12(2,3)22-10(16)5-9(11(17)20-4)14-13(6-15(18)19)7-21-8-13/h9,14H,5-8H2,1-4H3/t9-/m0/s1.
What are the key properties of 4-O-tert-butyl 1-O-methyl (2S)-2-[[3-(nitromethyl)oxetan-3-yl]amino]butanedioate?
4-O-tert-butyl 1-O-methyl (2S)-2-[[3-(nitromethyl)oxetan-3-yl]amino]butanedioate has a molecular weight of 318.33 g/mol, XLogP of -0.10, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-tert-butyl 1-O-methyl (2S)-2-[[3-(nitromethyl)oxetan-3-yl]amino]butanedioate is sourced from PubChem (CID 135031824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).