C30H34N2O5S — CID 155772801
tert-butyl (2R)-2-[[3-(nitromethyl)oxetan-3-yl]amino]-3-tritylsulfanylpropanoate (PubChem CID 155772801) has the molecular formula C30H34N2O5S and a molecular weight of 534.68 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[3-(nitromethyl)oxetan-3-yl]amino]-3-tritylsulfanylpropanoate.
| Compound Name | tert-butyl (2R)-2-[[3-(nitromethyl)oxetan-3-yl]amino]-3-tritylsulfanylpropanoate |
|---|---|
| PubChem CID | 155772801 |
| Molecular Formula | C30H34N2O5S |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | tert-butyl (2R)-2-[[3-(nitromethyl)oxetan-3-yl]amino]-3-tritylsulfanylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC1(C[N+](=O)[O-])COC1 |
| InChI | InChI=1S/C30H34N2O5S/c1-28(2,3)37-27(33)26(31-29(20-32(34)35)21-36-22-29)19-38-30(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,26,31H,19-22H2,1-3H3/t26-/m0/s1 |
| InChIKey | HOPVWLWZSCZRAO-SANMLTNESA-N |
| XLogP | 5.06 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|